C22H36Cl2N4O3 — CID 161168424
1-amino-N-[(2R)-1-(3-morpholin-4-ylpropylamino)-1-oxo-3-phenylpropan-2-yl]cyclopentane-1-carboxamide;dihydrochloride (PubChem CID 161168424) has the molecular formula C22H36Cl2N4O3 and a molecular weight of 475.46 g/mol. Its IUPAC name is 1-amino-N-[(2R)-1-(3-morpholin-4-ylpropylamino)-1-oxo-3-phenylpropan-2-yl]cyclopentane-1-carboxamide;dihydrochloride.
| Compound Name | 1-amino-N-[(2R)-1-(3-morpholin-4-ylpropylamino)-1-oxo-3-phenylpropan-2-yl]cyclopentane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 161168424 |
| Molecular Formula | C22H36Cl2N4O3 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-amino-N-[(2R)-1-(3-morpholin-4-ylpropylamino)-1-oxo-3-phenylpropan-2-yl]cyclopentane-1-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)N[C@H](Cc2ccccc2)C(=O)NCCCN2CCOCC2)CCCC1 |
| InChI | InChI=1S/C22H34N4O3.2ClH/c23-22(9-4-5-10-22)21(28)25-19(17-18-7-2-1-3-8-18)20(27)24-11-6-12-26-13-15-29-16-14-26;;/h1-3,7-8,19H,4-6,9-17,23H2,(H,24,27)(H,25,28);2*1H/t19-;;/m1../s1 |
| InChIKey | UQWAJIRZXJKBAN-JQDLGSOUSA-N |
| XLogP | 1.67 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|