C11H20NO8PS — CID 161171122
phosphanylformic acid;prop-2-enoic acid;1-(prop-2-enoylamino)butane-2-sulfonic acid (PubChem CID 161171122) has the molecular formula C11H20NO8PS and a molecular weight of 357.32 g/mol. Its IUPAC name is phosphanylformic acid;prop-2-enoic acid;1-(prop-2-enoylamino)butane-2-sulfonic acid.
| Compound Name | phosphanylformic acid;prop-2-enoic acid;1-(prop-2-enoylamino)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 161171122 |
| Molecular Formula | C11H20NO8PS |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | phosphanylformic acid;prop-2-enoic acid;1-(prop-2-enoylamino)butane-2-sulfonic acid |
| SMILES | C=CC(=O)NCC(CC)S(=O)(=O)O.C=CC(=O)O.O=C(O)P |
| InChI | InChI=1S/C7H13NO4S.C3H4O2.CH3O2P/c1-3-6(13(10,11)12)5-8-7(9)4-2;1-2-3(4)5;2-1(3)4/h4,6H,2-3,5H2,1H3,(H,8,9)(H,10,11,12);2H,1H2,(H,4,5);4H2,(H,2,3) |
| InChIKey | UREMVMDCLBNWQH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|