C10H22N2O8S — CID 88818934
2-(2-hydroxyethoxyamino)oxyethanol;1-(prop-2-enoylamino)propane-2-sulfonic acid (PubChem CID 88818934) has the molecular formula C10H22N2O8S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(2-hydroxyethoxyamino)oxyethanol;1-(prop-2-enoylamino)propane-2-sulfonic acid.
| Compound Name | 2-(2-hydroxyethoxyamino)oxyethanol;1-(prop-2-enoylamino)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 88818934 |
| Molecular Formula | C10H22N2O8S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 2-(2-hydroxyethoxyamino)oxyethanol;1-(prop-2-enoylamino)propane-2-sulfonic acid |
| SMILES | C=CC(=O)NCC(C)S(=O)(=O)O.OCCONOCCO |
| InChI | InChI=1S/C6H11NO4S.C4H11NO4/c1-3-6(8)7-4-5(2)12(9,10)11;6-1-3-8-5-9-4-2-7/h3,5H,1,4H2,2H3,(H,7,8)(H,9,10,11);5-7H,1-4H2 |
| InChIKey | SZGYZLCGLIXKCU-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|