About decanoic acid;propane
decanoic acid;propane (PubChem CID 161171156) has the molecular formula C13H28O2
and a molecular weight of 216.36 g/mol. Its IUPAC name is decanoic acid;propane.
Molecular Properties
| Compound Name | decanoic acid;propane |
| PubChem CID | 161171156 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | decanoic acid;propane |
| SMILES | CCC.CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O2.C3H8/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-2/h2-9H2,1H3,(H,11,12);3H2,1-2H3 |
| InChIKey | UREQMYUQOFODGL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoic acid;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoic acid;propane?
The IUPAC name of decanoic acid;propane (CID 161171156) is decanoic acid;propane.
What is the SMILES notation for decanoic acid;propane?
The canonical SMILES for decanoic acid;propane is CCC.CCCCCCCCCC(=O)O.
What is the InChIKey of decanoic acid;propane?
The InChIKey is UREQMYUQOFODGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C3H8/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-2/h2-9H2,1H3,(H,11,12);3H2,1-2H3.
What are the key properties of decanoic acid;propane?
decanoic acid;propane has a molecular weight of 216.36 g/mol, XLogP of 4.63, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decanoic acid;propane is sourced from PubChem (CID 161171156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).