About 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol
2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol (PubChem CID 161176809) has the molecular formula C25H32N2O2
and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol |
| PubChem CID | 161176809 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol |
| SMILES | CNC(C)C(O)c1ccccc1.CNC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H17NO.C10H15NO/c1-16-14(12-8-4-2-5-9-12)15(17)13-10-6-3-7-11-13;1-8(11-2)10(12)9-6-4-3-5-7-9/h2-11,14-17H,1H3;3-8,10-12H,1-2H3 |
| InChIKey | URXOGSUXDOCZHP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol?
The IUPAC name of 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol (CID 161176809) is 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol.
What is the SMILES notation for 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol?
The canonical SMILES for 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol is CNC(C)C(O)c1ccccc1.CNC(c1ccccc1)C(O)c1ccccc1.
What is the InChIKey of 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol?
The InChIKey is URXOGSUXDOCZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO.C10H15NO/c1-16-14(12-8-4-2-5-9-12)15(17)13-10-6-3-7-11-13;1-8(11-2)10(12)9-6-4-3-5-7-9/h2-11,14-17H,1H3;3-8,10-12H,1-2H3.
What are the key properties of 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol?
2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol has a molecular weight of 392.54 g/mol, XLogP of 4.01, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-1,2-diphenylethanol;2-(methylamino)-1-phenylpropan-1-ol is sourced from PubChem (CID 161176809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).