C28H63N3 — CID 161186269
ethane;bis(1-methylazepane);1-methyl-2-methylideneazepane (PubChem CID 161186269) has the molecular formula C28H63N3 and a molecular weight of 441.83 g/mol. Its IUPAC name is ethane;bis(1-methylazepane);1-methyl-2-methylideneazepane.
| Compound Name | ethane;bis(1-methylazepane);1-methyl-2-methylideneazepane |
|---|---|
| PubChem CID | 161186269 |
| Molecular Formula | C28H63N3 |
| Molecular Weight | 441.83 g/mol |
| Exact Mass | 441.50 |
| IUPAC Name | ethane;bis(1-methylazepane);1-methyl-2-methylideneazepane |
| SMILES | C=C1CCCCCN1C.CC.CC.CC.CN1CCCCCC1.CN1CCCCCC1 |
| InChI | InChI=1S/C8H15N.2C7H15N.3C2H6/c1-8-6-4-3-5-7-9(8)2;2*1-8-6-4-2-3-5-7-8;3*1-2/h1,3-7H2,2H3;2*2-7H2,1H3;3*1-2H3 |
| InChIKey | UTCSMJCQUKCBAD-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.83 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |