C8H12N2O3 — CID 161190422
carbon dioxide;4,5-diethyl-1,2-dihydropyrazol-3-one (PubChem CID 161190422) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is carbon dioxide;4,5-diethyl-1,2-dihydropyrazol-3-one.
| Compound Name | carbon dioxide;4,5-diethyl-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 161190422 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | carbon dioxide;4,5-diethyl-1,2-dihydropyrazol-3-one |
| SMILES | CCc1[nH][nH]c(=O)c1CC.O=C=O |
| InChI | InChI=1S/C7H12N2O.CO2/c1-3-5-6(4-2)8-9-7(5)10;2-1-3/h3-4H2,1-2H3,(H2,8,9,10); |
| InChIKey | UTQJZQXZRCVJEM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |