C17H16IN7 — CID 161196497
iodomethane;N-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 161196497) has the molecular formula C17H16IN7 and a molecular weight of 445.27 g/mol. Its IUPAC name is iodomethane;N-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | iodomethane;N-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 161196497 |
| Molecular Formula | C17H16IN7 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | iodomethane;N-(5-methyl-1H-1,2,4-triazol-3-yl)-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | CI.Cc1nc(Nc2nc(-c3ccncc3)nc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C16H13N7.CH3I/c1-10-18-16(23-22-10)21-15-12-4-2-3-5-13(12)19-14(20-15)11-6-8-17-9-7-11;1-2/h2-9H,1H3,(H2,18,19,20,21,22,23);1H3 |
| InChIKey | UUKJHEITUHQGDJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|