C23H17FN4 — CID 164985419
N-(4-fluoro-2-methyl-1H-inden-5-yl)-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 164985419) has the molecular formula C23H17FN4 and a molecular weight of 368.42 g/mol. Its IUPAC name is N-(4-fluoro-2-methyl-1H-inden-5-yl)-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-(4-fluoro-2-methyl-1H-inden-5-yl)-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 164985419 |
| Molecular Formula | C23H17FN4 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(4-fluoro-2-methyl-1H-inden-5-yl)-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | CC1=Cc2c(ccc(Nc3nc(-c4ccncc4)nc4ccccc34)c2F)C1 |
| InChI | InChI=1S/C23H17FN4/c1-14-12-16-6-7-20(21(24)18(16)13-14)27-23-17-4-2-3-5-19(17)26-22(28-23)15-8-10-25-11-9-15/h2-11,13H,12H2,1H3,(H,26,27,28) |
| InChIKey | GBZJLDBRSRKESI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |