C17H30F6N4O2 — CID 161201486
methane;bis((3S)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide) (PubChem CID 161201486) has the molecular formula C17H30F6N4O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is methane;bis((3S)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide).
| Compound Name | methane;bis((3S)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide) |
|---|---|
| PubChem CID | 161201486 |
| Molecular Formula | C17H30F6N4O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | methane;bis((3S)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide) |
| SMILES | C.O=C(NCC(F)(F)F)[C@H]1CCCNC1.O=C(NCC(F)(F)F)[C@H]1CCCNC1 |
| InChI | InChI=1S/2C8H13F3N2O.CH4/c2*9-8(10,11)5-13-7(14)6-2-1-3-12-4-6;/h2*6,12H,1-5H2,(H,13,14);1H4/t2*6-;/m00./s1 |
| InChIKey | UVANVTFSYODIPD-UAIGZDOSSA-N |
| XLogP | 1.97 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |