C19H22NO3S+ — CID 161203922
6-methyl-2-(2-methylprop-1-enyl)-1-propylbenzo[cd]indol-1-ium;sulfur trioxide (PubChem CID 161203922) has the molecular formula C19H22NO3S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-methyl-2-(2-methylprop-1-enyl)-1-propylbenzo[cd]indol-1-ium;sulfur trioxide.
| Compound Name | 6-methyl-2-(2-methylprop-1-enyl)-1-propylbenzo[cd]indol-1-ium;sulfur trioxide |
|---|---|
| PubChem CID | 161203922 |
| Molecular Formula | C19H22NO3S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 6-methyl-2-(2-methylprop-1-enyl)-1-propylbenzo[cd]indol-1-ium;sulfur trioxide |
| SMILES | CCC[N+]1=C(C=C(C)C)c2cccc3c(C)ccc1c23.O=S(=O)=O |
| InChI | InChI=1S/C19H22N.O3S/c1-5-11-20-17-10-9-14(4)15-7-6-8-16(19(15)17)18(20)12-13(2)3;1-4(2)3/h6-10,12H,5,11H2,1-4H3;/q+1; |
| InChIKey | UVIRFVOCNKZGBE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|