C24H19N3O5 — CID 161204810
carbon dioxide;1-phenylethyl N-[5-(6-ethynyl-1H-indol-2-yl)-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 161204810) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is carbon dioxide;1-phenylethyl N-[5-(6-ethynyl-1H-indol-2-yl)-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | carbon dioxide;1-phenylethyl N-[5-(6-ethynyl-1H-indol-2-yl)-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 161204810 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | carbon dioxide;1-phenylethyl N-[5-(6-ethynyl-1H-indol-2-yl)-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | C#Cc1ccc2cc(-c3onc(C)c3NC(=O)OC(C)c3ccccc3)[nH]c2c1.O=C=O |
| InChI | InChI=1S/C23H19N3O3.CO2/c1-4-16-10-11-18-13-20(24-19(18)12-16)22-21(14(2)26-29-22)25-23(27)28-15(3)17-8-6-5-7-9-17;2-1-3/h1,5-13,15,24H,2-3H3,(H,25,27); |
| InChIKey | UVLMRPDXAYUCMU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|