C14H19N3O7S2 — CID 161208597
methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate (PubChem CID 161208597) has the molecular formula C14H19N3O7S2 and a molecular weight of 405.45 g/mol. Its IUPAC name is methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate.
| Compound Name | methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate |
|---|---|
| PubChem CID | 161208597 |
| Molecular Formula | C14H19N3O7S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate |
| SMILES | CC(=O)Nc1ccc(-c2ccccn2)c(S(N)(=O)=O)c1.CS(=O)(=O)O.O |
| InChI | InChI=1S/C13H13N3O3S.CH4O3S.H2O/c1-9(17)16-10-5-6-11(12-4-2-3-7-15-12)13(8-10)20(14,18)19;1-5(2,3)4;/h2-8H,1H3,(H,16,17)(H2,14,18,19);1H3,(H,2,3,4);1H2 |
| InChIKey | VUSORFNBMCWVTB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 188.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|