About methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate
methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate (PubChem CID 161208597) has the molecular formula C14H19N3O7S2
and a molecular weight of 405.45 g/mol. Its IUPAC name is methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate.
Molecular Properties
| Compound Name | methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate |
| PubChem CID | 161208597 |
| Molecular Formula | C14H19N3O7S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate |
| SMILES | CC(=O)Nc1ccc(-c2ccccn2)c(S(N)(=O)=O)c1.CS(=O)(=O)O.O |
| InChI | InChI=1S/C13H13N3O3S.CH4O3S.H2O/c1-9(17)16-10-5-6-11(12-4-2-3-7-15-12)13(8-10)20(14,18)19;1-5(2,3)4;/h2-8H,1H3,(H,16,17)(H2,14,18,19);1H3,(H,2,3,4);1H2 |
| InChIKey | VUSORFNBMCWVTB-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 188.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate?
The IUPAC name of methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate (CID 161208597) is methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate.
What is the SMILES notation for methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate?
The canonical SMILES for methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate is CC(=O)Nc1ccc(-c2ccccn2)c(S(N)(=O)=O)c1.CS(=O)(=O)O.O.
What is the InChIKey of methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate?
The InChIKey is VUSORFNBMCWVTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O3S.CH4O3S.H2O/c1-9(17)16-10-5-6-11(12-4-2-3-7-15-12)13(8-10)20(14,18)19;1-5(2,3)4;/h2-8H,1H3,(H,16,17)(H2,14,18,19);1H3,(H,2,3,4);1H2.
What are the key properties of methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate?
methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate has a molecular weight of 405.45 g/mol, XLogP of 0.03, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;N-(4-pyridin-2-yl-3-sulfamoylphenyl)acetamide;hydrate is sourced from PubChem (CID 161208597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).