C47H69O9P — CID 161210230
[bis(2,6-dibutoxybenzoyl)-bis(2-methylpropyl)-λ5-phosphanyl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 161210230) has the molecular formula C47H69O9P and a molecular weight of 809.03 g/mol. Its IUPAC name is [bis(2,6-dibutoxybenzoyl)-bis(2-methylpropyl)-λ5-phosphanyl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [bis(2,6-dibutoxybenzoyl)-bis(2-methylpropyl)-λ5-phosphanyl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 161210230 |
| Molecular Formula | C47H69O9P |
| Molecular Weight | 809.03 g/mol |
| Exact Mass | 808.47 |
| IUPAC Name | [bis(2,6-dibutoxybenzoyl)-bis(2-methylpropyl)-λ5-phosphanyl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | CCCCOc1cccc(OCCCC)c1C(=O)P(CC(C)C)(CC(C)C)(C(=O)c1ccc(OC)cc1OC)C(=O)c1c(OCCCC)cccc1OCCCC |
| InChI | InChI=1S/C47H69O9P/c1-11-15-27-53-38-21-19-22-39(54-28-16-12-2)43(38)46(49)57(32-34(5)6,33-35(7)8,45(48)37-26-25-36(51-9)31-42(37)52-10)47(50)44-40(55-29-17-13-3)23-20-24-41(44)56-30-18-14-4/h19-26,31,34-35H,11-18,27-30,32-33H2,1-10H3 |
| InChIKey | UWDFOJNTWAJBQA-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.03 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|