C33H42O2 — CID 161213677
(1R,5S)-8,8-dimethyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene;(1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene (PubChem CID 161213677) has the molecular formula C33H42O2 and a molecular weight of 470.70 g/mol. Its IUPAC name is (1R,5S)-8,8-dimethyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene;(1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene.
| Compound Name | (1R,5S)-8,8-dimethyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene;(1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
|---|---|
| PubChem CID | 161213677 |
| Molecular Formula | C33H42O2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (1R,5S)-8,8-dimethyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene;(1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
| SMILES | C=C1CC(C)(C)C2=C1C1C=C[C@]3(CCC[C@H]3C2)O1.C=C1C[C@H](C)C2=C1C1C=C[C@]3(CCC[C@H]3C2)O1 |
| InChI | InChI=1S/C17H22O.C16H20O/c1-11-10-16(2,3)13-9-12-5-4-7-17(12)8-6-14(18-17)15(11)13;1-10-8-11(2)15-13(10)9-12-4-3-6-16(12)7-5-14(15)17-16/h6,8,12,14H,1,4-5,7,9-10H2,2-3H3;5,7,10,12,14H,2-4,6,8-9H2,1H3/t12-,14?,17-;10-,12-,14?,16-/m00/s1 |
| InChIKey | UWOOQELILIMGJE-KJRDLOOQSA-N |
| XLogP | 7.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|