C18H24O — CID 140937731
(1R,5S,7R,12R)-7-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene (PubChem CID 140937731) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is (1R,5S,7R,12R)-7-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene.
| Compound Name | (1R,5S,7R,12R)-7-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene |
|---|---|
| PubChem CID | 140937731 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (1R,5S,7R,12R)-7-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene |
| SMILES | C=C(C)C1=C2[C@H]3C=C[C@]4(CCC[C@H]4C[C@@]2(C)CC1)O3 |
| InChI | InChI=1S/C18H24O/c1-12(2)14-6-9-17(3)11-13-5-4-8-18(13)10-7-15(19-18)16(14)17/h7,10,13,15H,1,4-6,8-9,11H2,2-3H3/t13-,15+,17+,18-/m0/s1 |
| InChIKey | BLGGNBZIGKIGNH-NZPGVSJUSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|