C16H20O — CID 161213678
(1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene (PubChem CID 161213678) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is (1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene.
| Compound Name | (1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
|---|---|
| PubChem CID | 161213678 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1R,5S,8S)-8-methyl-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
| SMILES | C=C1C[C@H](C)C2=C1C1C=C[C@]3(CCC[C@H]3C2)O1 |
| InChI | InChI=1S/C16H20O/c1-10-8-11(2)15-13(10)9-12-4-3-6-16(12)7-5-14(15)17-16/h5,7,10,12,14H,2-4,6,8-9H2,1H3/t10-,12-,14?,16-/m0/s1 |
| InChIKey | OTVKHWWSGFRTSX-VOUNODSOSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|