C15H18O — CID 155929907
(1S,3R,4S,7S,12R)-3,10-bis(ethenyl)-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene (PubChem CID 155929907) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (1S,3R,4S,7S,12R)-3,10-bis(ethenyl)-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene.
| Compound Name | (1S,3R,4S,7S,12R)-3,10-bis(ethenyl)-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene |
|---|---|
| PubChem CID | 155929907 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (1S,3R,4S,7S,12R)-3,10-bis(ethenyl)-8-oxatricyclo[5.4.1.04,12]dodeca-5,10-diene |
| SMILES | C=CC1=C[C@@H]2C[C@H](C=C)[C@@H]3C=C[C@H](OC1)[C@@H]32 |
| InChI | InChI=1S/C15H18O/c1-3-10-7-12-8-11(4-2)13-5-6-14(15(12)13)16-9-10/h3-7,11-15H,1-2,8-9H2/t11-,12+,13-,14-,15+/m0/s1 |
| InChIKey | NCBIABLCMFARIR-AIEDFZFUSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|