C17H20O — CID 155930659
(1S,6R,8S,14R,15S)-4-ethenyl-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene (PubChem CID 155930659) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (1S,6R,8S,14R,15S)-4-ethenyl-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene.
| Compound Name | (1S,6R,8S,14R,15S)-4-ethenyl-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene |
|---|---|
| PubChem CID | 155930659 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (1S,6R,8S,14R,15S)-4-ethenyl-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene |
| SMILES | C=CC1=C[C@H]2C[C@H]3C=CCCC4=C[C@@H](OC1)[C@@H]2[C@H]43 |
| InChI | InChI=1S/C17H20O/c1-2-11-7-14-8-12-5-3-4-6-13-9-15(18-10-11)17(14)16(12)13/h2-3,5,7,9,12,14-17H,1,4,6,8,10H2/t12-,14+,15-,16+,17-/m1/s1 |
| InChIKey | FFPAFXXAIHKMSD-LMLQULGWSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|