C15H18O — CID 155930658
(1S,6R,8S,14R,15S)-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene (PubChem CID 155930658) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (1S,6R,8S,14R,15S)-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene.
| Compound Name | (1S,6R,8S,14R,15S)-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene |
|---|---|
| PubChem CID | 155930658 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (1S,6R,8S,14R,15S)-2-oxatetracyclo[11.2.1.06,15.08,14]hexadeca-4,9,13(16)-triene |
| SMILES | C1=C[C@@H]2C[C@@H]3C=CCO[C@@H]4C=C(CC1)[C@H]2[C@H]34 |
| InChI | InChI=1S/C15H18O/c1-2-5-12-9-13-15-11(6-3-7-16-13)8-10(4-1)14(12)15/h1,3-4,6,9-11,13-15H,2,5,7-8H2/t10-,11+,13-,14+,15-/m1/s1 |
| InChIKey | FRSNHMDWXNERCE-QFCKPIOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|