C18H24O — CID 138514514
8-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene (PubChem CID 138514514) has the molecular formula C18H24O and a molecular weight of 256.39 g/mol. Its IUPAC name is 8-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene.
| Compound Name | 8-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene |
|---|---|
| PubChem CID | 138514514 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 8-methyl-10-prop-1-en-2-yl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-10,13-diene |
| SMILES | C=C(C)C1=C2C3C=CC4(CCCC4CC2C(C)C1)O3 |
| InChI | InChI=1S/C18H24O/c1-11(2)14-9-12(3)15-10-13-5-4-7-18(13)8-6-16(19-18)17(14)15/h6,8,12-13,15-16H,1,4-5,7,9-10H2,2-3H3 |
| InChIKey | PEBITOQFRGWMAF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|