C15H18O — CID 160995173
(1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene (PubChem CID 160995173) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene.
| Compound Name | (1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
|---|---|
| PubChem CID | 160995173 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-diene |
| SMILES | C=C1CCC2=C1C1C=C[C@]3(CCC[C@H]3C2)O1 |
| InChI | InChI=1S/C15H18O/c1-10-4-5-11-9-12-3-2-7-15(12)8-6-13(16-15)14(10)11/h6,8,12-13H,1-5,7,9H2/t12-,13?,15-/m0/s1 |
| InChIKey | CFKFJCJHBORKAS-YOYPFHDYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|