C18H26OSi — CID 160995178
trimethyl-[(1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-12-yl]silane (PubChem CID 160995178) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is trimethyl-[(1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-12-yl]silane.
| Compound Name | trimethyl-[(1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-12-yl]silane |
|---|---|
| PubChem CID | 160995178 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | trimethyl-[(1R,5S)-10-methylidene-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-12-yl]silane |
| SMILES | C=C1CCC2=C1C1([Si](C)(C)C)C=C[C@]3(CCC[C@H]3C2)O1 |
| InChI | InChI=1S/C18H26OSi/c1-13-7-8-14-12-15-6-5-9-17(15)10-11-18(19-17,16(13)14)20(2,3)4/h10-11,15H,1,5-9,12H2,2-4H3/t15-,17-,18?/m0/s1 |
| InChIKey | HAPXPOJFSZCXAK-LUIZSJORSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|