C27H27N3O4 — CID 161215163
O-[4-[1,2-bis(4-aminooxyphenyl)-2-(4-methoxyphenyl)ethyl]phenyl]hydroxylamine (PubChem CID 161215163) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is O-[4-[1,2-bis(4-aminooxyphenyl)-2-(4-methoxyphenyl)ethyl]phenyl]hydroxylamine.
| Compound Name | O-[4-[1,2-bis(4-aminooxyphenyl)-2-(4-methoxyphenyl)ethyl]phenyl]hydroxylamine |
|---|---|
| PubChem CID | 161215163 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | O-[4-[1,2-bis(4-aminooxyphenyl)-2-(4-methoxyphenyl)ethyl]phenyl]hydroxylamine |
| SMILES | COc1ccc(C(c2ccc(ON)cc2)C(c2ccc(ON)cc2)c2ccc(ON)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-31-22-10-2-18(3-11-22)26(19-4-12-23(32-28)13-5-19)27(20-6-14-24(33-29)15-7-20)21-8-16-25(34-30)17-9-21/h2-17,26-27H,28-30H2,1H3 |
| InChIKey | NISOCDYUVFTYDY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|