C16H18N2O6 — CID 161220240
2-[(2,4-dimethoxyphenyl)-(2-methylimidazol-1-yl)methyl]propanedioic acid (PubChem CID 161220240) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)-(2-methylimidazol-1-yl)methyl]propanedioic acid.
| Compound Name | 2-[(2,4-dimethoxyphenyl)-(2-methylimidazol-1-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 161220240 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)-(2-methylimidazol-1-yl)methyl]propanedioic acid |
| SMILES | COc1ccc(C(C(C(=O)O)C(=O)O)n2ccnc2C)c(OC)c1 |
| InChI | InChI=1S/C16H18N2O6/c1-9-17-6-7-18(9)14(13(15(19)20)16(21)22)11-5-4-10(23-2)8-12(11)24-3/h4-8,13-14H,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | UXKDYCAEKGQVDA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|