C26H52O2 — CID 161224488
4-methyltridec-1-en-3-ol;2-methylundecanal (PubChem CID 161224488) has the molecular formula C26H52O2 and a molecular weight of 396.70 g/mol. Its IUPAC name is 4-methyltridec-1-en-3-ol;2-methylundecanal.
| Compound Name | 4-methyltridec-1-en-3-ol;2-methylundecanal |
|---|---|
| PubChem CID | 161224488 |
| Molecular Formula | C26H52O2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.40 |
| IUPAC Name | 4-methyltridec-1-en-3-ol;2-methylundecanal |
| SMILES | C=CC(O)C(C)CCCCCCCCC.CCCCCCCCCC(C)C=O |
| InChI | InChI=1S/C14H28O.C12H24O/c1-4-6-7-8-9-10-11-12-13(3)14(15)5-2;1-3-4-5-6-7-8-9-10-12(2)11-13/h5,13-15H,2,4,6-12H2,1,3H3;11-12H,3-10H2,1-2H3 |
| InChIKey | UXYBPYYBVXEANM-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|