2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid

C22H23NO2 — CID 161230600

IUPAC2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid
SMILESCc1ccc(C)n1-c1cc(CCCc2ccccc2)ccc1C(=O)O
InChIInChI=1S/C22H23NO2/c1-16-11-12-17(2)23(16)21-15-19(13-14-20(21)22(24)25)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-15H,6,9-10H2,1-2H3,(H,24,25)
InChIKeySZCVAQPGANHNGY-UHFFFAOYSA-N
MW333.43 g/mol
LogP4.97
Rot. Bonds6

About 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid

2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid (PubChem CID 161230600) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid.

Molecular Properties

Compound Name2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid
PubChem CID161230600
Molecular FormulaC22H23NO2
Molecular Weight333.43 g/mol
Exact Mass333.17
IUPAC Name2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid
SMILESCc1ccc(C)n1-c1cc(CCCc2ccccc2)ccc1C(=O)O
InChIInChI=1S/C22H23NO2/c1-16-11-12-17(2)23(16)21-15-19(13-14-20(21)22(24)25)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-15H,6,9-10H2,1-2H3,(H,24,25)
InChIKeySZCVAQPGANHNGY-UHFFFAOYSA-N
XLogP4.97
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.43
LogP ≤ 54.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}

Analyze 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid?
The IUPAC name of 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid (CID 161230600) is 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid.
What is the SMILES notation for 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid?
The canonical SMILES for 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid is Cc1ccc(C)n1-c1cc(CCCc2ccccc2)ccc1C(=O)O.
What is the InChIKey of 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid?
The InChIKey is SZCVAQPGANHNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2/c1-16-11-12-17(2)23(16)21-15-19(13-14-20(21)22(24)25)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-15H,6,9-10H2,1-2H3,(H,24,25).
What are the key properties of 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid?
2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid has a molecular weight of 333.43 g/mol, XLogP of 4.97, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrrol-1-yl)-4-(3-phenylpropyl)benzoic acid is sourced from PubChem (CID 161230600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).