C35H48NO12+ — CID 161230913
(9R,10S)-10-(1,3-benzodioxol-5-yl)-10-hydroxy-1-(4-propan-2-yloxyphenyl)-9-(pyrrolidin-1-ium-1-ylmethyl)decane-1,7-dione;(2S,3S)-2,3-dihydroxybutanedioic acid (PubChem CID 161230913) has the molecular formula C35H48NO12+ and a molecular weight of 674.76 g/mol. Its IUPAC name is (9R,10S)-10-(1,3-benzodioxol-5-yl)-10-hydroxy-1-(4-propan-2-yloxyphenyl)-9-(pyrrolidin-1-ium-1-ylmethyl)decane-1,7-dione;(2S,3S)-2,3-dihydroxybutanedioic acid.
| Compound Name | (9R,10S)-10-(1,3-benzodioxol-5-yl)-10-hydroxy-1-(4-propan-2-yloxyphenyl)-9-(pyrrolidin-1-ium-1-ylmethyl)decane-1,7-dione;(2S,3S)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 161230913 |
| Molecular Formula | C35H48NO12+ |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | (9R,10S)-10-(1,3-benzodioxol-5-yl)-10-hydroxy-1-(4-propan-2-yloxyphenyl)-9-(pyrrolidin-1-ium-1-ylmethyl)decane-1,7-dione;(2S,3S)-2,3-dihydroxybutanedioic acid |
| SMILES | CC(C)Oc1ccc(C(=O)CCCCCC(=O)C[C@H](C[NH+]2CCCC2)[C@H](O)c2ccc3c(c2)OCO3)cc1.O=C(O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C31H41NO6.C4H6O6/c1-22(2)38-27-13-10-23(11-14-27)28(34)9-5-3-4-8-26(33)18-25(20-32-16-6-7-17-32)31(35)24-12-15-29-30(19-24)37-21-36-29;5-1(3(7)8)2(6)4(9)10/h10-15,19,22,25,31,35H,3-9,16-18,20-21H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/p+1/t25-,31-;1-,2-/m10/s1 |
| InChIKey | VRDDFQRZKRXPJH-YDJMXYHJSA-O |
| XLogP | 2.20 |
| TPSA | 201.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|