C36H47NO6 — CID 143934729
(2S,3R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[2,7-dioxo-7-(4-propan-2-yloxyphenyl)heptyl]cyclopropen-1-yl]-4-(pentylamino)butanal (PubChem CID 143934729) has the molecular formula C36H47NO6 and a molecular weight of 589.77 g/mol. Its IUPAC name is (2S,3R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[2,7-dioxo-7-(4-propan-2-yloxyphenyl)heptyl]cyclopropen-1-yl]-4-(pentylamino)butanal.
| Compound Name | (2S,3R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[2,7-dioxo-7-(4-propan-2-yloxyphenyl)heptyl]cyclopropen-1-yl]-4-(pentylamino)butanal |
|---|---|
| PubChem CID | 143934729 |
| Molecular Formula | C36H47NO6 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | (2S,3R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[2-[2,7-dioxo-7-(4-propan-2-yloxyphenyl)heptyl]cyclopropen-1-yl]-4-(pentylamino)butanal |
| SMILES | CCCCCNC[C@@H](C1=C(CC(=O)CCCCC(=O)c2ccc(OC(C)C)cc2)C1)[C@H](C=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C36H47NO6/c1-4-5-8-17-37-23-32(33(24-38)27-13-16-35-36(22-27)42-19-18-41-35)31-21-28(31)20-29(39)9-6-7-10-34(40)26-11-14-30(15-12-26)43-25(2)3/h11-16,22,24-25,32-33,37H,4-10,17-21,23H2,1-3H3/t32-,33+/m0/s1 |
| InChIKey | CXHXMFFVSGCNMB-JHOUSYSJSA-N |
| XLogP | 7.03 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|