C33H50N2O9 — CID 161233152
1-O-tert-butyl 3-O-ethyl 3-benzoylpiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl piperidine-1,3-dicarboxylate (PubChem CID 161233152) has the molecular formula C33H50N2O9 and a molecular weight of 618.77 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 3-benzoylpiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 3-benzoylpiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 161233152 |
| Molecular Formula | C33H50N2O9 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.35 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 3-benzoylpiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl piperidine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)c2ccccc2)CCCN(C(=O)OC(C)(C)C)C1.CCOC(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H27NO5.C13H23NO4/c1-5-25-17(23)20(16(22)15-10-7-6-8-11-15)12-9-13-21(14-20)18(24)26-19(2,3)4;1-5-17-11(15)10-7-6-8-14(9-10)12(16)18-13(2,3)4/h6-8,10-11H,5,9,12-14H2,1-4H3;10H,5-9H2,1-4H3 |
| InChIKey | UZAGZIMBOJUPBM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|