C13H16F3NO2 — CID 161235286
3,4-dihydro-2H-pyrrole;toluene;2,2,2-trifluoroacetic acid (PubChem CID 161235286) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyrrole;toluene;2,2,2-trifluoroacetic acid.
| Compound Name | 3,4-dihydro-2H-pyrrole;toluene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161235286 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3,4-dihydro-2H-pyrrole;toluene;2,2,2-trifluoroacetic acid |
| SMILES | C1=NCCC1.Cc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H8.C4H7N.C2HF3O2/c1-7-5-3-2-4-6-7;1-2-4-5-3-1;3-2(4,5)1(6)7/h2-6H,1H3;3H,1-2,4H2;(H,6,7) |
| InChIKey | UZHBBILMZZCORA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |