C37H30BrO5+ — CID 161237616
[4-[7-methyl-3,5-bis(phenylmethoxy)chromenylium-2-yl]-2-phenylmethoxyphenyl] hypobromite (PubChem CID 161237616) has the molecular formula C37H30BrO5+ and a molecular weight of 634.55 g/mol. Its IUPAC name is [4-[7-methyl-3,5-bis(phenylmethoxy)chromenylium-2-yl]-2-phenylmethoxyphenyl] hypobromite.
| Compound Name | [4-[7-methyl-3,5-bis(phenylmethoxy)chromenylium-2-yl]-2-phenylmethoxyphenyl] hypobromite |
|---|---|
| PubChem CID | 161237616 |
| Molecular Formula | C37H30BrO5+ |
| Molecular Weight | 634.55 g/mol |
| Exact Mass | 633.13 |
| IUPAC Name | [4-[7-methyl-3,5-bis(phenylmethoxy)chromenylium-2-yl]-2-phenylmethoxyphenyl] hypobromite |
| SMILES | Cc1cc(OCc2ccccc2)c2cc(OCc3ccccc3)c(-c3ccc(OBr)c(OCc4ccccc4)c3)[o+]c2c1 |
| InChI | InChI=1S/C37H30BrO5/c1-26-19-33(39-23-27-11-5-2-6-12-27)31-22-36(41-25-29-15-9-4-10-16-29)37(42-34(31)20-26)30-17-18-32(43-38)35(21-30)40-24-28-13-7-3-8-14-28/h2-22H,23-25H2,1H3/q+1 |
| InChIKey | AHDAOEPRLCAEMR-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.55 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|