C7H14N2O5S — CID 161238757
1,2-diazaspiro[4.4]nonan-9-one;sulfuric acid (PubChem CID 161238757) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is 1,2-diazaspiro[4.4]nonan-9-one;sulfuric acid.
| Compound Name | 1,2-diazaspiro[4.4]nonan-9-one;sulfuric acid |
|---|---|
| PubChem CID | 161238757 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,2-diazaspiro[4.4]nonan-9-one;sulfuric acid |
| SMILES | O=C1CCCC12CCNN2.O=S(=O)(O)O |
| InChI | InChI=1S/C7H12N2O.H2O4S/c10-6-2-1-3-7(6)4-5-8-9-7;1-5(2,3)4/h8-9H,1-5H2;(H2,1,2,3,4) |
| InChIKey | UZSIJMCGPRLFPE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|