C8H15ClN2O — CID 115018345
1,8-diazaspiro[4.5]decan-4-one;hydrochloride (PubChem CID 115018345) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 1,8-diazaspiro[4.5]decan-4-one;hydrochloride.
| Compound Name | 1,8-diazaspiro[4.5]decan-4-one;hydrochloride |
|---|---|
| PubChem CID | 115018345 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1,8-diazaspiro[4.5]decan-4-one;hydrochloride |
| SMILES | Cl.O=C1CCNC12CCNCC2 |
| InChI | InChI=1S/C8H14N2O.ClH/c11-7-1-4-10-8(7)2-5-9-6-3-8;/h9-10H,1-6H2;1H |
| InChIKey | SDYUMDRYQFPQJD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |