C44H40N6O2 — CID 161244562
2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)benzimidazole;4-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]aniline (PubChem CID 161244562) has the molecular formula C44H40N6O2 and a molecular weight of 684.84 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)benzimidazole;4-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]aniline.
| Compound Name | 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)benzimidazole;4-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 161244562 |
| Molecular Formula | C44H40N6O2 |
| Molecular Weight | 684.84 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | 2-(4-nitrophenyl)-1-(2,4,6-trimethylphenyl)benzimidazole;4-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]aniline |
| SMILES | Cc1cc(C)c(-n2c(-c3ccc(N)cc3)nc3ccccc32)c(C)c1.Cc1cc(C)c(-n2c(-c3ccc([N+](=O)[O-])cc3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C22H19N3O2.C22H21N3/c1-14-12-15(2)21(16(3)13-14)24-20-7-5-4-6-19(20)23-22(24)17-8-10-18(11-9-17)25(26)27;1-14-12-15(2)21(16(3)13-14)25-20-7-5-4-6-19(20)24-22(25)17-8-10-18(23)11-9-17/h4-13H,1-3H3;4-13H,23H2,1-3H3 |
| InChIKey | VALMWJZDSDVLFH-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 104.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.84 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|