C7H16O6P2 — CID 161247712
(3R,4S,6S)-2-(hydroxymethyl)-6-[methyl(phosphanyl)phosphanyl]oxyoxane-3,4,5-triol (PubChem CID 161247712) has the molecular formula C7H16O6P2 and a molecular weight of 258.15 g/mol. Its IUPAC name is (3R,4S,6S)-2-(hydroxymethyl)-6-[methyl(phosphanyl)phosphanyl]oxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,6S)-2-(hydroxymethyl)-6-[methyl(phosphanyl)phosphanyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 161247712 |
| Molecular Formula | C7H16O6P2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (3R,4S,6S)-2-(hydroxymethyl)-6-[methyl(phosphanyl)phosphanyl]oxyoxane-3,4,5-triol |
| SMILES | CP(P)O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C7H16O6P2/c1-15(14)13-7-6(11)5(10)4(9)3(2-8)12-7/h3-11H,2,14H2,1H3/t3?,4-,5-,6?,7-,15?/m0/s1 |
| InChIKey | WDCLGYUAWLHTRK-IQQSATILSA-N |
| XLogP | -1.38 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|