C58H47BBrF3N4O2 — CID 161247728
4-bromo-1-tritylpyrazole;4-(2-methylphenyl)-1-tritylpyrazole;[2-(trifluoromethyl)phenyl]boronic acid (PubChem CID 161247728) has the molecular formula C58H47BBrF3N4O2 and a molecular weight of 979.75 g/mol. Its IUPAC name is 4-bromo-1-tritylpyrazole;4-(2-methylphenyl)-1-tritylpyrazole;[2-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | 4-bromo-1-tritylpyrazole;4-(2-methylphenyl)-1-tritylpyrazole;[2-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 161247728 |
| Molecular Formula | C58H47BBrF3N4O2 |
| Molecular Weight | 979.75 g/mol |
| Exact Mass | 978.29 |
| IUPAC Name | 4-bromo-1-tritylpyrazole;4-(2-methylphenyl)-1-tritylpyrazole;[2-(trifluoromethyl)phenyl]boronic acid |
| SMILES | Brc1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.Cc1ccccc1-c1cnn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c1.OB(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H24N2.C22H17BrN2.C7H6BF3O2/c1-23-13-11-12-20-28(23)24-21-30-31(22-24)29(25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27;23-21-16-24-25(17-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;9-7(10,11)5-3-1-2-4-6(5)8(12)13/h2-22H,1H3;1-17H;1-4,12-13H |
| InChIKey | VAVWWAVHNQJQFK-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.75 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|