C52H44BBrF6N4O2 — CID 158502503
4-bromo-3-(trifluoromethyl)-1-tritylpyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole (PubChem CID 158502503) has the molecular formula C52H44BBrF6N4O2 and a molecular weight of 961.65 g/mol. Its IUPAC name is 4-bromo-3-(trifluoromethyl)-1-tritylpyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole.
| Compound Name | 4-bromo-3-(trifluoromethyl)-1-tritylpyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole |
|---|---|
| PubChem CID | 158502503 |
| Molecular Formula | C52H44BBrF6N4O2 |
| Molecular Weight | 961.65 g/mol |
| Exact Mass | 960.26 |
| IUPAC Name | 4-bromo-3-(trifluoromethyl)-1-tritylpyrazole;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)-1-tritylpyrazole |
| SMILES | CC1(C)OB(c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)nc2C(F)(F)F)OC1(C)C.FC(F)(F)c1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1Br |
| InChI | InChI=1S/C29H28BF3N2O2.C23H16BrF3N2/c1-26(2)27(3,4)37-30(36-26)24-20-35(34-25(24)29(31,32)33)28(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23;24-20-16-29(28-21(20)23(25,26)27)22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h5-20H,1-4H3;1-16H |
| InChIKey | HKBITSJTGCVRFG-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.65 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|