C22H31N4O7PS — CID 161251353
N-[1-[4-[[(1S,3aS)-3a,4-dihydro-3H-[1,3,2]oxazaphospholo[3,4-a]indol-1-yl]oxy]-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide;sulfane;tritiooxymethane (PubChem CID 161251353) has the molecular formula C22H31N4O7PS and a molecular weight of 529.57 g/mol. Its IUPAC name is N-[1-[4-[[(1S,3aS)-3a,4-dihydro-3H-[1,3,2]oxazaphospholo[3,4-a]indol-1-yl]oxy]-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide;sulfane;tritiooxymethane.
| Compound Name | N-[1-[4-[[(1S,3aS)-3a,4-dihydro-3H-[1,3,2]oxazaphospholo[3,4-a]indol-1-yl]oxy]-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide;sulfane;tritiooxymethane |
|---|---|
| PubChem CID | 161251353 |
| Molecular Formula | C22H31N4O7PS |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | N-[1-[4-[[(1S,3aS)-3a,4-dihydro-3H-[1,3,2]oxazaphospholo[3,4-a]indol-1-yl]oxy]-5-(deuteriomethyl)-3-methoxyoxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide;sulfane;tritiooxymethane |
| SMILES | S.[2H]CC1OC(n2ccc(NC(C)=O)nc2=O)C(OC)C1O[P@]1OC[C@@H]2Cc3ccccc3N21.[3H]OC |
| InChI | InChI=1S/C21H25N4O6P.CH4O.H2S/c1-12-18(31-32-25-15(11-29-32)10-14-6-4-5-7-16(14)25)19(28-3)20(30-12)24-9-8-17(22-13(2)26)23-21(24)27;1-2;/h4-9,12,15,18-20H,10-11H2,1-3H3,(H,22,23,26,27);2H,1H3;1H2/t12?,15-,18?,19?,20?,32-;;/m0../s1/i1D;2T; |
| InChIKey | VBHWGXNGYIWZBP-KAXGKRIHSA-N |
| XLogP | 1.93 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|