C21H34N3O8PS — CID 76815617
S-[2-[2-[5-(4-acetamido-2-oxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate (PubChem CID 76815617) has the molecular formula C21H34N3O8PS and a molecular weight of 519.56 g/mol. Its IUPAC name is S-[2-[2-[5-(4-acetamido-2-oxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate.
| Compound Name | S-[2-[2-[5-(4-acetamido-2-oxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 76815617 |
| Molecular Formula | C21H34N3O8PS |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | S-[2-[2-[5-(4-acetamido-2-oxopyrimidin-1-yl)-2-ethyl-4-methoxyoxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate |
| SMILES | CCC1OC(n2ccc(NC(C)=O)nc2=O)C(OC)C1OPOCCOCCSC(=O)C(C)C |
| InChI | InChI=1S/C21H34N3O8PS/c1-6-15-17(32-33-30-10-9-29-11-12-34-20(26)13(2)3)18(28-5)19(31-15)24-8-7-16(22-14(4)25)23-21(24)27/h7-8,13,15,17-19,33H,6,9-12H2,1-5H3,(H,22,23,25,27) |
| InChIKey | BIWBSPLKXRAZLT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|