C21H33N2O9PS — CID 91298741
S-[2-[2-[5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(prop-1-en-2-yloxymethyl)oxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate (PubChem CID 91298741) has the molecular formula C21H33N2O9PS and a molecular weight of 520.54 g/mol. Its IUPAC name is S-[2-[2-[5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(prop-1-en-2-yloxymethyl)oxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate.
| Compound Name | S-[2-[2-[5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(prop-1-en-2-yloxymethyl)oxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 91298741 |
| Molecular Formula | C21H33N2O9PS |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | S-[2-[2-[5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(prop-1-en-2-yloxymethyl)oxolan-3-yl]oxyphosphanyloxyethoxy]ethyl] 2-methylpropanethioate |
| SMILES | C=C(C)OCC1OC(n2ccc(=O)[nH]c2=O)C(OC)C1OPOCCOCCSC(=O)C(C)C |
| InChI | InChI=1S/C21H33N2O9PS/c1-13(2)20(25)34-11-10-28-8-9-30-33-32-17-15(12-29-14(3)4)31-19(18(17)27-5)23-7-6-16(24)22-21(23)26/h6-7,13,15,17-19,33H,3,8-12H2,1-2,4-5H3,(H,22,24,26) |
| InChIKey | FQIWCDGVMWYPBY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|