C15H20FNO3 — CID 161251606
4-(3-fluoro-4-piperidin-1-ylphenoxy)oxolan-3-ol (PubChem CID 161251606) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-(3-fluoro-4-piperidin-1-ylphenoxy)oxolan-3-ol.
| Compound Name | 4-(3-fluoro-4-piperidin-1-ylphenoxy)oxolan-3-ol |
|---|---|
| PubChem CID | 161251606 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(3-fluoro-4-piperidin-1-ylphenoxy)oxolan-3-ol |
| SMILES | OC1COCC1Oc1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C15H20FNO3/c16-12-8-11(20-15-10-19-9-14(15)18)4-5-13(12)17-6-2-1-3-7-17/h4-5,8,14-15,18H,1-3,6-7,9-10H2 |
| InChIKey | ODIYAFHIRVJUJA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|