C15H38Cl2MnN6 — CID 161252729
dichloromanganese;methane;4-[(2S)-1,4,7,10,13-pentazacyclopentadec-2-yl]butan-1-amine (PubChem CID 161252729) has the molecular formula C15H38Cl2MnN6 and a molecular weight of 428.36 g/mol. Its IUPAC name is dichloromanganese;methane;4-[(2S)-1,4,7,10,13-pentazacyclopentadec-2-yl]butan-1-amine.
| Compound Name | dichloromanganese;methane;4-[(2S)-1,4,7,10,13-pentazacyclopentadec-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 161252729 |
| Molecular Formula | C15H38Cl2MnN6 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | dichloromanganese;methane;4-[(2S)-1,4,7,10,13-pentazacyclopentadec-2-yl]butan-1-amine |
| SMILES | C.Cl[Mn]Cl.NCCCC[C@H]1CNCCNCCNCCNCCN1 |
| InChI | InChI=1S/C14H34N6.CH4.2ClH.Mn/c15-4-2-1-3-14-13-19-10-9-17-6-5-16-7-8-18-11-12-20-14;;;;/h14,16-20H,1-13,15H2;1H4;2*1H;/q;;;;+2/p-2/t14-;;;;/m0..../s1 |
| InChIKey | VBMGPKAROAHAKU-XCYGSCDUSA-L |
| XLogP | 0.46 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|