C32H32N6O6S4 — CID 161259539
5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 161259539) has the molecular formula C32H32N6O6S4 and a molecular weight of 724.91 g/mol. Its IUPAC name is 5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 161259539 |
| Molecular Formula | C32H32N6O6S4 |
| Molecular Weight | 724.91 g/mol |
| Exact Mass | 724.13 |
| IUPAC Name | 5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;5-[[4-[2-[methyl(1,3-thiazol-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(CCOc1ccc(C=C2SC(=O)NC2=O)cc1)c1nccs1.CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1nccs1 |
| InChI | InChI=1S/C16H17N3O3S2.C16H15N3O3S2/c2*1-19(15-17-6-9-23-15)7-8-22-12-4-2-11(3-5-12)10-13-14(20)18-16(21)24-13/h2-6,9,13H,7-8,10H2,1H3,(H,18,20,21);2-6,9-10H,7-8H2,1H3,(H,18,20,21) |
| InChIKey | VCJHNFSQONFJQP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.91 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|