C17H17F3N4O2 — CID 161264062
benzyl 6-phenyl-5-(trifluoromethyl)tetrazinane-2-carboxylate (PubChem CID 161264062) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is benzyl 6-phenyl-5-(trifluoromethyl)tetrazinane-2-carboxylate.
| Compound Name | benzyl 6-phenyl-5-(trifluoromethyl)tetrazinane-2-carboxylate |
|---|---|
| PubChem CID | 161264062 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | benzyl 6-phenyl-5-(trifluoromethyl)tetrazinane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1NNC(C(F)(F)F)C(c2ccccc2)N1 |
| InChI | InChI=1S/C17H17F3N4O2/c18-17(19,20)15-14(13-9-5-2-6-10-13)22-24(23-21-15)16(25)26-11-12-7-3-1-4-8-12/h1-10,14-15,21-23H,11H2 |
| InChIKey | VCXZKSNMGLBNJZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |