About 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol
4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol (PubChem CID 161266100) has the molecular formula C20H25Br2FN2O4
and a molecular weight of 536.24 g/mol. Its IUPAC name is 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol.
Molecular Properties
| Compound Name | 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol |
| PubChem CID | 161266100 |
| Molecular Formula | C20H25Br2FN2O4 |
| Molecular Weight | 536.24 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol |
| SMILES | Brc1ccnc(OC2CCCOC2)c1.Fc1cc(Br)ccn1.OC1CCCOC1 |
| InChI | InChI=1S/C10H12BrNO2.C5H3BrFN.C5H10O2/c11-8-3-4-12-10(6-8)14-9-2-1-5-13-7-9;6-4-1-2-8-5(7)3-4;6-5-2-1-3-7-4-5/h3-4,6,9H,1-2,5,7H2;1-3H;5-6H,1-4H2 |
| InChIKey | VDEYVMSRDRZOHL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol?
The IUPAC name of 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol (CID 161266100) is 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol.
What is the SMILES notation for 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol?
The canonical SMILES for 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol is Brc1ccnc(OC2CCCOC2)c1.Fc1cc(Br)ccn1.OC1CCCOC1.
What is the InChIKey of 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol?
The InChIKey is VDEYVMSRDRZOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2.C5H3BrFN.C5H10O2/c11-8-3-4-12-10(6-8)14-9-2-1-5-13-7-9;6-4-1-2-8-5(7)3-4;6-5-2-1-3-7-4-5/h3-4,6,9H,1-2,5,7H2;1-3H;5-6H,1-4H2.
What are the key properties of 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol?
4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol has a molecular weight of 536.24 g/mol, XLogP of 4.54, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-fluoropyridine;4-bromo-2-(oxan-3-yloxy)pyridine;oxan-3-ol is sourced from PubChem (CID 161266100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).