C19H21F4NO2S — CID 161267205
ethyl 2-[5-[2-fluoro-5-(trifluoromethyl)phenyl]pentyl]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 161267205) has the molecular formula C19H21F4NO2S and a molecular weight of 403.44 g/mol. Its IUPAC name is ethyl 2-[5-[2-fluoro-5-(trifluoromethyl)phenyl]pentyl]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-[2-fluoro-5-(trifluoromethyl)phenyl]pentyl]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 161267205 |
| Molecular Formula | C19H21F4NO2S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl 2-[5-[2-fluoro-5-(trifluoromethyl)phenyl]pentyl]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CCCCCc2cc(C(F)(F)F)ccc2F)sc1C |
| InChI | InChI=1S/C19H21F4NO2S/c1-3-26-18(25)17-12(2)27-16(24-17)8-6-4-5-7-13-11-14(19(21,22)23)9-10-15(13)20/h9-11H,3-8H2,1-2H3 |
| InChIKey | VDIOBMMGAGXDAP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|