C12H18N2O6S — CID 166597361
ethyl 2-[(dimethylamino)methyl]-5-methyl-1,3-thiazole-4-carboxylate;oxalic acid (PubChem CID 166597361) has the molecular formula C12H18N2O6S and a molecular weight of 318.35 g/mol. Its IUPAC name is ethyl 2-[(dimethylamino)methyl]-5-methyl-1,3-thiazole-4-carboxylate;oxalic acid.
| Compound Name | ethyl 2-[(dimethylamino)methyl]-5-methyl-1,3-thiazole-4-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 166597361 |
| Molecular Formula | C12H18N2O6S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | ethyl 2-[(dimethylamino)methyl]-5-methyl-1,3-thiazole-4-carboxylate;oxalic acid |
| SMILES | CCOC(=O)c1nc(CN(C)C)sc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H16N2O2S.C2H2O4/c1-5-14-10(13)9-7(2)15-8(11-9)6-12(3)4;3-1(4)2(5)6/h5-6H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | JZIUIYMCCBJGGY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|