C19H25NO3S — CID 161136638
ethyl 2-[5-(4-methoxyphenyl)pentyl]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 161136638) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl 2-[5-(4-methoxyphenyl)pentyl]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[5-(4-methoxyphenyl)pentyl]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 161136638 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl 2-[5-(4-methoxyphenyl)pentyl]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CCCCCc2ccc(OC)cc2)sc1C |
| InChI | InChI=1S/C19H25NO3S/c1-4-23-19(21)18-14(2)24-17(20-18)9-7-5-6-8-15-10-12-16(22-3)13-11-15/h10-13H,4-9H2,1-3H3 |
| InChIKey | UMWQORPONRCXJH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|