C20H46O5Si2 — CID 161271829
1-[2-[methoxy(dimethyl)silyl]ethoxy]propan-2-ol;4-[2-[methoxy(dimethyl)silyl]ethyl]-2-methylcyclohexan-1-ol (PubChem CID 161271829) has the molecular formula C20H46O5Si2 and a molecular weight of 422.76 g/mol. Its IUPAC name is 1-[2-[methoxy(dimethyl)silyl]ethoxy]propan-2-ol;4-[2-[methoxy(dimethyl)silyl]ethyl]-2-methylcyclohexan-1-ol.
| Compound Name | 1-[2-[methoxy(dimethyl)silyl]ethoxy]propan-2-ol;4-[2-[methoxy(dimethyl)silyl]ethyl]-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 161271829 |
| Molecular Formula | C20H46O5Si2 |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 1-[2-[methoxy(dimethyl)silyl]ethoxy]propan-2-ol;4-[2-[methoxy(dimethyl)silyl]ethyl]-2-methylcyclohexan-1-ol |
| SMILES | CO[Si](C)(C)CCC1CCC(O)C(C)C1.CO[Si](C)(C)CCOCC(C)O |
| InChI | InChI=1S/C12H26O2Si.C8H20O3Si/c1-10-9-11(5-6-12(10)13)7-8-15(3,4)14-2;1-8(9)7-11-5-6-12(3,4)10-2/h10-13H,5-9H2,1-4H3;8-9H,5-7H2,1-4H3 |
| InChIKey | VDXPOPXUUQCASL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|